CAS 872707-78-3
:4-Pyrimidinecarboxaldehyde, 2-(dimethylamino)-
Description:
4-Pyrimidinecarboxaldehyde, 2-(dimethylamino)- is an organic compound characterized by its pyrimidine ring structure, which is a six-membered heterocyclic aromatic ring containing two nitrogen atoms at positions 1 and 3. This compound features an aldehyde functional group (-CHO) at the 4-position and a dimethylamino group (-N(CH3)2) at the 2-position of the pyrimidine ring. The presence of the aldehyde group makes it a reactive species, capable of participating in various chemical reactions, including condensation and nucleophilic addition. The dimethylamino group contributes to the compound's basicity and can influence its solubility and reactivity in different solvents. This compound may be utilized in various applications, including pharmaceuticals and agrochemicals, due to its potential biological activity. Its molecular structure allows for interactions with biological targets, making it of interest in medicinal chemistry. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled.
Formula:C7H9N3O
InChI:InChI=1/C7H9N3O/c1-10(2)7-8-4-3-6(5-11)9-7/h3-5H,1-2H3
SMILES:CN(C)c1nccc(C=O)n1
Synonyms:- 2-(Dimethylamino)-4-pyrimidinecarbaldehyde
- 2-(Dimethylamino)pyrimidine-4-carbaldehyde
- 4-pyrimidinecarboxaldehyde, 2-(dimethylamino)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
