CymitQuimica logo

CAS 872714-71-1

:

[1,3]Oxathiolo[5,4-c]pyridine-6-methanol

Description:
[1,3]Oxathiolo[5,4-c]pyridine-6-methanol is a heterocyclic compound characterized by the presence of an oxathiolane ring fused to a pyridine structure. This compound features a sulfur atom within the oxathiolane ring, contributing to its unique chemical properties. The methanol group at the 6-position of the pyridine ring enhances its reactivity and solubility in polar solvents. Typically, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The presence of both sulfur and nitrogen atoms in the structure can influence the compound's electronic properties, potentially affecting its interactions with biological targets. Additionally, the compound's stability, solubility, and reactivity can be influenced by the functional groups present, which may also dictate its applications in various chemical reactions or as a pharmaceutical agent. Overall, [1,3]Oxathiolo[5,4-c]pyridine-6-methanol represents a class of compounds that may have significant implications in both synthetic and medicinal chemistry.
Formula:C7H7NO2S
InChI:InChI=1S/C7H7NO2S/c9-3-5-1-7-6(2-8-5)10-4-11-7/h1-2,9H,3-4H2
InChI key:InChIKey=QJTBGQTVACLGDB-UHFFFAOYSA-N
SMILES:C(O)C=1C=C2C(=CN1)OCS2
Synonyms:
  • [1,3]Oxathiolo[5,4-c]pyridine-6-methanol
  • ([1,3]Oxathiolo[5,4-c]pyridin-6-yl)methanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.