CAS 872728-82-0
:N-[4-(2,5-Dihydro-5-oxo-1,2,4-oxadiazol-3-yl)phenyl]glycine
Description:
N-[4-(2,5-Dihydro-5-oxo-1,2,4-oxadiazol-3-yl)phenyl]glycine, with the CAS number 872728-82-0, is a chemical compound that features a glycine moiety linked to a phenyl group, which is further substituted with a 2,5-dihydro-5-oxo-1,2,4-oxadiazole ring. This structure suggests that the compound may exhibit both amino acid-like properties due to the glycine component and potential bioactivity associated with the oxadiazole ring, which is known for its presence in various pharmacologically active compounds. The oxadiazole moiety can contribute to the compound's stability and reactivity, potentially influencing its interactions in biological systems. The presence of the phenyl group may enhance lipophilicity, affecting the compound's solubility and permeability. Overall, this compound may be of interest in medicinal chemistry, particularly in the development of new therapeutic agents, due to its unique structural features and potential biological activities. Further studies would be necessary to elucidate its specific properties and applications.
Formula:C10H9N3O4
InChI:InChI=1S/C10H9N3O4/c14-8(15)5-11-7-3-1-6(2-4-7)9-12-10(16)17-13-9/h1-4,11H,5H2,(H,14,15)(H,12,13,16)
InChI key:InChIKey=USTVSOSEROPCIX-UHFFFAOYSA-N
SMILES:O=C1NC(C2=CC=C(NCC(O)=O)C=C2)=NO1
Synonyms:- 2-((4-(5-Oxo-4,5-dihydro-1,2,4-oxadiazol-3-yl)phenyl)amino)acetic acid
- 2-((4-(5-Oxo-4,5-dihydro-1,2,4-oxadiazol-3-yl)phenyl)amino)aceticacid
- 2-(4-(5-Oxo-4,5-Dihydro-1,2,4-Oxadiazol-3-Yl)Phenylamino)Acetic Acid
- N-[4-(2,5-Dihydro-5-oxo-1,2,4-oxadiazol-3-yl)phenyl]glycine
- N-[4-(5-Oxo-4,5-Dihydro-1,2,4-Oxadiazol-3-Yl)Phenyl]Glycine
- Glycine, N-[4-(2,5-dihydro-5-oxo-1,2,4-oxadiazol-3-yl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-(4-(5-Oxo-4,5-dihydro-1,2,4-oxadiazol-3-yl)phenylamino)acetic acid
CAS:Formula:C10H9N3O4Molecular weight:235.1962
