CAS 87273-20-9
:2-(Chloromethyl)-4-methoxypyrimidine
Description:
2-(Chloromethyl)-4-methoxypyrimidine is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. This compound features a chloromethyl group (-CH2Cl) at the 2-position and a methoxy group (-OCH3) at the 4-position of the pyrimidine ring, contributing to its reactivity and potential applications in organic synthesis. It is typically a colorless to pale yellow liquid or solid, depending on its form, and is soluble in organic solvents. The presence of the chloromethyl group makes it a useful intermediate in the synthesis of various pharmaceuticals and agrochemicals, as it can undergo nucleophilic substitution reactions. Additionally, the methoxy group can influence the compound's electronic properties and reactivity. Safety data indicates that it should be handled with care, as it may be harmful if inhaled or ingested, and appropriate safety measures should be taken during its use in laboratory settings.
Formula:C6H7ClN2O
InChI:InChI=1S/C6H7ClN2O/c1-10-6-2-3-8-5(4-7)9-6/h2-3H,4H2,1H3
InChI key:InChIKey=BXXYMGJGHBOBFE-UHFFFAOYSA-N
SMILES:O(C)C1=NC(CCl)=NC=C1
Synonyms:- Pyrimidine, 2-(chloromethyl)-4-methoxy-
- 2-(Chloromethyl)-4-methoxypyrimidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
