CAS 872850-30-1

1,1-Dimethylethyl 4-(cyanomethyl)-4-methyl-1-piperidinecarboxylate

Description:

1,1-Dimethylethyl 4-(cyanomethyl)-4-methyl-1-piperidinecarboxylate, identified by its CAS number 872850-30-1, is a chemical compound that features a piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. This compound is characterized by the presence of a carboxylate functional group, which contributes to its potential reactivity and solubility properties. The presence of both cyanomethyl and dimethyl groups indicates that it may exhibit unique electronic and steric properties, influencing its behavior in chemical reactions. Typically, such compounds may be of interest in medicinal chemistry due to their potential biological activity, particularly in the development of pharmaceuticals. The structural features suggest that it may participate in nucleophilic reactions or serve as a building block in organic synthesis. Additionally, the stability and reactivity of this compound can be influenced by factors such as temperature, solvent, and the presence of other reagents. Overall, this compound represents a specific class of organic molecules with potential applications in various fields, including drug development and synthetic chemistry.

Formula: C₁₃H₂₂N₂O₂

InChI: InChI=1S/C13H22N2O2/c1-12(2,3)17-11(16)15-9-6-13(4,5-8-14)7-10-15/h5-7,9-10H2,1-4H3

InChI key: InChIKey=PRMYRRODTPOYIU-UHFFFAOYSA-N

SMILES: C(C#N)C1(C)CCN(C(OC(C)(C)C)=O)CC1

Synonyms:

• 4-Cyanomethyl-4-methylpiperidine-1-carboxylic acid tert-butyl ester
• 1,1-Dimethylethyl 4-(cyanomethyl)-4-methyl-1-piperidinecarboxylate
• tert-Butyl 4-(cyanomethyl)-4-methylpiperidine-1-carboxylate
• 1-Piperidinecarboxylic acid, 4-(cyanomethyl)-4-methyl-, 1,1-dimethylethyl ester