CAS 87293-45-6
:2-Hydroxy-1-methylpropyl 1-(4-chlorobenzoyl)-5-methoxy-2-methyl-1H-indole-3-acetate
Description:
2-Hydroxy-1-methylpropyl 1-(4-chlorobenzoyl)-5-methoxy-2-methyl-1H-indole-3-acetate, with the CAS number 87293-45-6, is a synthetic compound that belongs to the class of indole derivatives. This substance features a complex molecular structure characterized by an indole core, which is a bicyclic structure composed of a benzene ring fused to a pyrrole ring. The presence of various functional groups, including a hydroxy group, a methoxy group, and an acetate moiety, contributes to its chemical reactivity and potential biological activity. The 4-chlorobenzoyl substituent indicates the presence of a chlorinated aromatic ring, which may influence the compound's pharmacological properties. Such compounds are often studied for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The specific characteristics, such as solubility, stability, and reactivity, would depend on the compound's molecular interactions and the environment in which it is studied. Further research is necessary to fully elucidate its properties and potential uses.
Formula:C23H24ClNO5
InChI:InChI=1S/C23H24ClNO5/c1-13-19(12-22(27)30-15(3)14(2)26)20-11-18(29-4)9-10-21(20)25(13)23(28)16-5-7-17(24)8-6-16/h5-11,14-15,26H,12H2,1-4H3
InChI key:InChIKey=ZJTNVASNQTXDQP-UHFFFAOYSA-N
SMILES:C(=O)(N1C=2C(C(CC(OC(C(C)O)C)=O)=C1C)=CC(OC)=CC2)C3=CC=C(Cl)C=C3
Synonyms:- 2-Hydroxy-1-methylpropyl 1-(4-chlorobenzoyl)-5-methoxy-2-methyl-1H-indole-3-acetate
- 1H-Indole-3-acetic acid, 1-(4-chlorobenzoyl)-5-methoxy-2-methyl-, 2-hydroxy-1-methylpropyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
