CAS 87294-21-1

3-Chloro-4-[4-(trifluoromethyl)phenoxy]benzenamine

Description:

3-Chloro-4-[4-(trifluoromethyl)phenoxy]benzenamine, with the CAS number 87294-21-1, is an organic compound characterized by its complex aromatic structure. It features a chloro group and a trifluoromethyl group, which significantly influence its chemical properties and reactivity. The presence of the trifluoromethyl group enhances the compound's lipophilicity and can affect its biological activity, making it of interest in pharmaceutical applications. The compound is likely to exhibit moderate to high stability under standard conditions, but its reactivity can be influenced by the presence of the amino and chloro functional groups. As an aromatic amine, it may participate in electrophilic substitution reactions and can act as a nucleophile in various chemical transformations. Additionally, the compound's solubility in organic solvents and potential interactions with biological systems make it relevant for studies in medicinal chemistry and material science. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks.

Formula: C₁₃H₉ClF₃NO

InChI: InChI=1S/C13H9ClF3NO/c14-11-7-9(18)3-6-12(11)19-10-4-1-8(2-5-10)13(15,16)17/h1-7H,18H2

InChI key: InChIKey=UHAWZYFAMAKLFQ-UHFFFAOYSA-N

SMILES: O(C1=C(Cl)C=C(N)C=C1)C2=CC=C(C(F)(F)F)C=C2

Synonyms:

• Benzenamine, 3-chloro-4-[4-(trifluoromethyl)phenoxy]-
• 3-Chloro-4-[4-(trifluoromethyl)phenoxy]aniline
• 3-Chloro-4-[4-(trifluoromethyl)phenoxy]benzenamine