CAS 87299-57-8

5-Sulfo-2-furancarboxylic acid

Description:

5-Sulfo-2-furancarboxylic acid is an organic compound characterized by its furan ring structure, which is a five-membered aromatic ring containing oxygen. This compound features a sulfonic acid group (-SO3H) and a carboxylic acid group (-COOH) attached to the furan ring, contributing to its acidic properties. It is typically a white to light yellow solid that is soluble in water due to the presence of the sulfonic and carboxylic acid groups, which enhance its polarity. The sulfonic acid group imparts strong acidity, making it a useful reagent in various chemical reactions, particularly in organic synthesis and as a potential intermediate in the production of dyes and pharmaceuticals. Additionally, its unique structure allows for potential applications in biochemistry and materials science. Safety data indicates that, like many sulfonic acids, it should be handled with care, as it may cause irritation to skin and eyes. Overall, 5-sulfo-2-furancarboxylic acid is a versatile compound with significant utility in both industrial and research settings.

Formula: C₅H₄O₆S

InChI: InChI=1/C5H4O6S/c6-5(7)3-1-2-4(11-3)12(8,9)10/h1-2H,(H,6,7)(H,8,9,10)

SMILES: c1cc(oc1C(=O)O)S(=O)(=O)O

Synonyms:

• 5-Sulfo-2-furoic acid
• 5-Sulfofuran-2-Carboxylic Acid

5-Sulfo-2-furancarboxylicacid bis-Sodium Salt

Controlled Product

CAS: 87299-57-8

Applications 5-Sulfo-2-furancarboxylicacid (CAS# 87299-57-8) is a useful research chemical compound.

Formula: C₅H₂Na₂O₆S

Color and Shape: Neat

Molecular weight: 236.11

Ref: TR-S223740