CAS 873-41-6

3,5,6-trichloro-1,2,4-triazine

Description:

3,5,6-Trichloro-1,2,4-triazine is a heterocyclic compound characterized by its triazine ring, which contains three nitrogen atoms and three carbon atoms, with chlorine substituents at the 3, 5, and 6 positions. This compound is typically a white to light yellow crystalline solid and is known for its stability under normal conditions. It is soluble in organic solvents but has limited solubility in water. 3,5,6-Trichloro-1,2,4-triazine is primarily used in the synthesis of various agrochemicals, particularly herbicides and fungicides, due to its ability to act as a chlorinating agent. The presence of chlorine atoms enhances its reactivity, making it useful in chemical reactions that require chlorination. Additionally, it exhibits moderate toxicity, necessitating careful handling and appropriate safety measures during its use in laboratory and industrial settings. Its chemical structure allows for various derivatives to be synthesized, expanding its utility in organic chemistry and agricultural applications.

Formula: C₃Cl₃N₃

InChI: InChI=1/C3Cl3N3/c4-1-2(5)8-9-3(6)7-1

SMILES: c1(c(Cl)nnc(Cl)n1)Cl

Synonyms:

• 1,2,4-Triazine, 3,5,6-Trichloro-
• 3,5,6-Trichloro-1,2,4-triazine

3,5,6-TRICHLORO-1,2,4-TRIAZINE

CAS: 873-41-6

Formula: C₃Cl₃N₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 184.4112

Ref: IN-DA004L1B

3,5,6-Trichloro-1,2,4-triazine

CAS: 873-41-6

3,5,6-Trichloro-1,2,4-triazine

Purity: 98%

Molecular weight: 184.41g/mol

Ref: 54-OR315527

3,5,6-Trichloro-1,2,4-triazine

CAS: 873-41-6

Formula: C₃Cl₃N₃

Purity: 95%

Color and Shape: Yellow powder

Molecular weight: 184.4

Ref: 10-F242691

3,5,6-Trichloro-[1,2,4]triazine

Controlled Product

CAS: 873-41-6

Formula: C₃Cl₃N₃

Color and Shape: Neat

Molecular weight: 184.411

Ref: TR-T774453