CAS 873-94-9
:3,3,5-Trimethylcyclohexanone
Description:
3,3,5-Trimethylcyclohexanone is a cyclic ketone characterized by its unique structure, which includes a cyclohexane ring with three methyl groups attached at the 3 and 5 positions. This compound is typically a colorless to pale yellow liquid with a distinctive odor. It is known for its relatively low volatility and moderate solubility in water, while being more soluble in organic solvents such as ethanol and ether. The presence of the ketone functional group contributes to its reactivity, making it useful in various chemical synthesis processes, including as an intermediate in the production of fragrances and other organic compounds. Additionally, 3,3,5-trimethylcyclohexanone exhibits stability under normal conditions but should be handled with care due to potential health hazards associated with inhalation or skin contact. Its physical and chemical properties, such as boiling point and density, can vary based on environmental conditions and purity levels. Overall, this compound is significant in both industrial applications and research contexts.
Formula:C9H16O
InChI:InChI=1S/C9H16O/c1-7-4-8(10)6-9(2,3)5-7/h7H,4-6H2,1-3H3
InChI key:InChIKey=POSWICCRDBKBMH-UHFFFAOYSA-N
SMILES:CC1(C)CC(C)CC(=O)C1
Synonyms:- (5R)-3,3,5-trimethylcyclohexanone
- (5S)-3,3,5-trimethylcyclohexanone
- 3,3,5-Trimethyl cyclohexanone
- 3,3,5-Trimethyl-1-cyclohexanone
- 3,3,5-Trimethylcyclohexan-1-one
- 3,5,5-Trimethylcyclohexanone
- Ai3-33978
- Cyclohexanone, 3,3,5-trimethyl-
- Dihydro-isophorone
- Dihydroisophorone
- 3,3,5-Trimethylcyclohexanone
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
3,3,5-Trimethylcyclohexanone
CAS:Formula:C9H16OPurity:>98.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:140.233,3,5-Trimethylcyclohexanone
CAS:Formula:C9H16OPurity:98%Color and Shape:LiquidMolecular weight:140.22273,3,5-Trimethylcyclohexanone
CAS:<p>3,3,5-Trimethylcyclohexanone</p>Formula:C9H16OPurity:95%Color and Shape: colourless liquidMolecular weight:140.22g/molRef: 54-OR939767
10gTo inquire25gTo inquire100gTo inquire2.5lTo inquire25mlTo inquire100mlTo inquire500mlTo inquire3,3,5-Trimethylcyclohexanone
CAS:Controlled ProductFormula:C9H16OColor and Shape:NeatMolecular weight:140.223,3,5-Trimethylcyclohexanone
CAS:Formula:C9H16OPurity:98%Color and Shape:LiquidMolecular weight:140.2263,3,5-Trimethylcyclohexanone
CAS:<p>3,3,5-Trimethylcyclohexanone is an intermediate in the synthesis of polymers and polyesters. This compound is a reactive hydrogenation product which can be used to produce polymers with desired properties. The unsaturated side chain of 3,3,5-trimethylcyclohexanone reacts with borohydride to form a ketal. After being converted to the corresponding acid chloride, the 3,3,5-trimethylcyclohexanone can be used for the synthesis of polyesters. This compound has also been shown to be an effective catalyst for producing β-unsaturated ketones from aldehydes and dienes.</p>Formula:C9H16OPurity:Min. 95%Color and Shape:Clear LiquidMolecular weight:140.23 g/mol





