CymitQuimica logo

CAS 873009-45-1

:

2-[(5-chlorothiophene-2-carbonyl)amino]acetic acid

Description:
2-[(5-chlorothiophene-2-carbonyl)amino]acetic acid, identified by its CAS number 873009-45-1, is a chemical compound characterized by its unique structure that includes a thiophene ring substituted with a chlorine atom and an acetic acid moiety. This compound features a carbonyl group attached to the thiophene, which contributes to its reactivity and potential biological activity. The presence of the amino group indicates that it can participate in various chemical reactions, including peptide bond formation. The chlorothiophene structure may impart specific electronic properties, influencing its interactions in biological systems. This compound is likely to exhibit polar characteristics due to the carboxylic acid group, which can affect its solubility in water and organic solvents. Additionally, the compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential biological activity stemming from the thiophene and amino acid functionalities. Overall, its unique structural features make it a compound of interest in various chemical and biological research fields.
Formula:C7H6ClNO3S
InChI:InChI=1/C7H6ClNO3S/c8-5-2-1-4(13-5)7(12)9-3-6(10)11/h1-2H,3H2,(H,9,12)(H,10,11)
SMILES:c1cc(Cl)sc1C(=O)NCC(=O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • N-[(5-Chloro-2-thienyl)carbonyl]glycine

    Controlled Product
    CAS:
    Formula:C7H6ClNO3S
    Color and Shape:Neat
    Molecular weight:219.645

    Ref: TR-C411800

    25mg
    1,509.00€