CAS 873055-24-4
:5-(Trifluoromethyl)-1H-indol-6-amine
Description:
5-(Trifluoromethyl)-1H-indol-6-amine is a chemical compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a trifluoromethyl group (-CF3) at the 5-position significantly influences its chemical properties, enhancing lipophilicity and potentially affecting its biological activity. The amino group (-NH2) at the 6-position contributes to its reactivity, allowing for various substitution reactions. This compound is often studied in the context of medicinal chemistry due to its potential applications in drug development, particularly in targeting specific biological pathways. Its unique electronic properties, derived from the trifluoromethyl group, can modulate interactions with biological targets, making it a subject of interest in pharmacological research. Additionally, the compound's stability and solubility characteristics are influenced by its functional groups, which are critical for its behavior in biological systems and during synthesis. Overall, 5-(Trifluoromethyl)-1H-indol-6-amine represents a versatile scaffold for further chemical modifications and investigations in various fields of chemistry and biology.
Formula:C9H7F3N2
InChI:InChI=1S/C9H7F3N2/c10-9(11,12)6-3-5-1-2-14-8(5)4-7(6)13/h1-4,14H,13H2
InChI key:InChIKey=QQZNJABYWKNVPQ-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C=C2C(=CC1N)NC=C2
Synonyms:- 5-Trifluoromethyl-1H-indole-6-amine
- 1H-Indol-6-amine, 5-(trifluoromethyl)-
- 5-(Trifluoromethyl)-1H-indol-6-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
