CAS 873055-56-2
:2,4-Bis(1,1-dimethylethyl)-6-nitrophenyl methyl carbonate
Description:
2,4-Bis(1,1-dimethylethyl)-6-nitrophenyl methyl carbonate, with the CAS number 873055-56-2, is an organic compound characterized by its complex structure, which includes a nitrophenyl group and a carbonate functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems due to its phenolic and carbonate components. It is likely to be a solid at room temperature, with moderate solubility in organic solvents, reflecting its hydrophobic nature. The presence of the nitro group suggests potential reactivity, particularly in electrophilic substitution reactions. Additionally, the bulky tert-butyl groups contribute to steric hindrance, which may influence its reactivity and interactions with other molecules. This compound may find applications in materials science, particularly in the development of polymers or as a reagent in organic synthesis. Safety data should be consulted for handling, as nitro compounds can pose health risks and environmental concerns. Overall, its unique structure and properties make it a subject of interest in various chemical research fields.
Formula:C16H23NO5
InChI:InChI=1S/C16H23NO5/c1-15(2,3)10-8-11(16(4,5)6)13(22-14(18)21-7)12(9-10)17(19)20/h8-9H,1-7H3
InChI key:InChIKey=AHCFUYGLDFAELY-UHFFFAOYSA-N
SMILES:O(C(OC)=O)C1=C(C(C)(C)C)C=C(C(C)(C)C)C=C1N(=O)=O
Synonyms:- 2,4-Di-tert-butyl-6-nitrophenyl methyl carbonate
- Carbonic acid, 2,4-bis(1,1-dimethylethyl)-6-nitrophenyl methyl ester
- Carbonic acid 2,4-di-tert-butyl-6-nitrophenyl ester methyl ester
- 2,4-Bis(1,1-dimethylethyl)-6-nitrophenyl methyl carbonate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
