
CAS 873056-10-1
:Ethanone, 1-(6′-aminospiro[cyclopropane-1,3′-[3H]indol]-1′(2′H)-yl)-, hydrochloride (1:1)
Description:
Ethanone, 1-(6′-aminospiro[cyclopropane-1,3′-[3H]indol]-1′(2′H)-yl)-, hydrochloride (1:1), with CAS number 873056-10-1, is a chemical compound characterized by its unique spirocyclic structure, which incorporates both cyclopropane and indole moieties. This compound features an ethanone functional group, indicating the presence of a carbonyl group adjacent to an ethyl group. The hydrochloride form suggests that the compound is a salt, which enhances its solubility in water and may influence its pharmacological properties. The presence of the amino group indicates potential for hydrogen bonding, which can affect its reactivity and interactions with biological targets. This compound may exhibit interesting biological activities due to its structural complexity, making it a candidate for research in medicinal chemistry. Its specific applications and effects would depend on further studies, including its mechanism of action and potential therapeutic uses. As with many compounds of this nature, safety and handling precautions should be observed, particularly in laboratory settings.
Formula:C12H14N2O·ClH
InChI:InChI=1S/C12H14N2O.ClH/c1-8(15)14-7-12(4-5-12)10-3-2-9(13)6-11(10)14;/h2-3,6H,4-5,7,13H2,1H3;1H
InChI key:InChIKey=BRXOBULOWOETHL-UHFFFAOYSA-N
SMILES:C(C)(=O)N1CC2(C=3C1=CC(N)=CC3)CC2.Cl
Synonyms:- Ethanone, 1-(6′-aminospiro[cyclopropane-1,3′-[3H]indol]-1′(2′H)-yl)-, hydrochloride (1:1)
- 1-(6′-Aminospiro[cyclopropane-1,3′-indolin]-1′-yl)ethanone hydrochloride
- Spiro[cyclopropane-1,3′-[3H]indol]-6′-amine, 1′-acetyl-1′,2′-dihydro-, monohydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.