CAS 873056-12-3
:tert-butyl 7-amino-4,4-dimethyl-2,3-dihydroquinoline-1-carboxylate
Description:
Tert-butyl 7-amino-4,4-dimethyl-2,3-dihydroquinoline-1-carboxylate is a chemical compound characterized by its complex structure, which includes a quinoline core, an amino group, and a tert-butyl ester functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems due to its fused ring structure. The presence of the amino group suggests potential for hydrogen bonding and reactivity, making it a candidate for various chemical reactions, including nucleophilic substitutions. The tert-butyl ester moiety contributes to its lipophilicity, which can influence its solubility in organic solvents and biological systems. Additionally, the dimethyl groups on the quinoline ring can affect the compound's steric hindrance and electronic properties, potentially impacting its biological activity. Such compounds may be of interest in medicinal chemistry for their potential pharmacological applications, including antimicrobial or anticancer activities, although specific biological data would be necessary to confirm such properties. Overall, this compound exemplifies the complexity and diversity of organic molecules in chemical research.
Formula:C16H24N2O2
InChI:InChI=1/C16H24N2O2/c1-15(2,3)20-14(19)18-9-8-16(4,5)12-7-6-11(17)10-13(12)18/h6-7,10H,8-9,17H2,1-5H3
SMILES:CC(C)(C)OC(=O)N1CCC(C)(C)c2ccc(cc12)N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
tert-Butyl 7-amino-4,4-dimethyl-3,4-dihydroquinoline-1(2H);-carboxylate
CAS:Formula:C16H24N2O2Molecular weight:276.3740
