CAS 87310-56-3
:N-{[(2Z)-but-2-en-1-yloxy]methyl}-2-chloro-N-(2,6-diethylphenyl)acetamide
Description:
N-{[(2Z)-but-2-en-1-yloxy]methyl}-2-chloro-N-(2,6-diethylphenyl)acetamide, with the CAS number 87310-56-3, is a synthetic organic compound characterized by its complex structure, which includes a chloroacetamide moiety and an allyloxy group. This compound typically exhibits properties associated with amides, such as moderate solubility in polar solvents and potential reactivity due to the presence of the chloro group. The presence of the diethylphenyl substituent may impart hydrophobic characteristics, influencing its solubility and interaction with biological systems. Additionally, the allyloxy group can participate in various chemical reactions, including polymerization and substitution reactions. The compound's unique structure suggests potential applications in pharmaceuticals or agrochemicals, where its specific reactivity and biological activity can be explored. However, detailed studies on its toxicity, stability, and environmental impact would be necessary to fully understand its characteristics and potential uses.
Formula:C17H24ClNO2
InChI:InChI=1/C17H24ClNO2/c1-4-7-11-21-13-19(16(20)12-18)17-14(5-2)9-8-10-15(17)6-3/h4,7-10H,5-6,11-13H2,1-3H3/b7-4-
InChI key:InChIKey=HZDIJTXDRLNTIS-DAXSKMNVSA-N
SMILES:C/C=C\COCN(C(=O)CCl)c1c(CC)cccc1CC
Synonyms:- 87310-56-3
- Acetamide, N-[(2-butenyloxy)methyl]-2-chloro-N-(2,6-diethylphenyl)-, (Z)-
- Acetamide, N-[[(2Z)-2-buten-1-yloxy]methyl]-2-chloro-N-(2,6-diethylphenyl)-
- Acetamide, N-[[(2Z)-2-butenyloxy]methyl]-2-chloro-N-(2,6-diethylphenyl)-
- Butenachlor
- Kh 218
- N-[[(2Z)-2-Butenyloxy]methyl]-2-chloro-N-(2,6-diethylphenyl)acetamide
- N-{[(2Z)-2-Buten-1-yloxy]methyl}-2-chlor-N-(2,6-diethylphenyl)acetamid
- N-{[(2Z)-2-Buten-1-yloxy]methyl}-2-chloro-N-(2,6-diethylphenyl)acetamide
- N-{[(2Z)-But-2-en-1-yloxy]methyl}-2-chlor-N-(2,6-diethylphenyl)acetamid
- N-{[(2Z)-But-2-en-1-yloxy]methyl}-2-chloro-N-(2,6-diethylphenyl)acetamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Butenachlor
CAS:Butenachlor is a pesticide, specifically a selective, soil-applied herbicide used for control of grass and some broad-leaved weeds.Formula:C17H24ClNO2Color and Shape:SolidMolecular weight:309.83Butenachlor
CAS:Butenachlor is a potent anticancer inhibitor that targets tumor kinases. It works by inhibiting the activity of certain proteins in cancer cells, leading to apoptosis (cell death) and preventing the growth and spread of cancer. Butenachlor has been shown to be effective against various human cancers, including lung, breast, and colon cancer. It is an analog of saxagliptin, a drug used to treat type 2 diabetes. Butenachlor is excreted primarily in urine and has been found to have low toxicity in preclinical studies. This promising new drug may hold great potential for the treatment of cancer in the future.Formula:C17H24ClNO2Purity:Min. 95%Molecular weight:309.8 g/mol

