CAS 873208-67-4

4-[5-(4-Methylphenyl)-1,3,4-oxadiazol-2-yl]benzoic acid

Description:

4-[5-(4-Methylphenyl)-1,3,4-oxadiazol-2-yl]benzoic acid, with the CAS number 873208-67-4, is a chemical compound characterized by its unique structure that includes a benzoic acid moiety and a 1,3,4-oxadiazole ring. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical and material science research. The presence of the oxadiazole ring often contributes to its stability and may enhance its interactions with biological targets. Additionally, the para-methylphenyl substituent can influence its electronic properties and hydrophobicity. Such compounds are often studied for their potential applications in drug development, particularly in areas requiring anti-inflammatory or antimicrobial activities. The specific characteristics, such as melting point, boiling point, and spectral data, would depend on experimental conditions and should be referenced from reliable chemical databases or literature for precise information.

Formula: C₁₆H₁₂N₂O₃

InChI: InChI=1S/C16H12N2O3/c1-10-2-4-11(5-3-10)14-17-18-15(21-14)12-6-8-13(9-7-12)16(19)20/h2-9H,1H3,(H,19,20)

InChI key: InChIKey=JUTSCTAOCYBXKF-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CC=C(C=2OC(=NN2)C3=CC=C(C)C=C3)C=C1

Synonyms:

• Benzoic acid, 4-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]-
• 4-[5-(4-Methylphenyl)-1,3,4-oxadiazol-2-yl]benzoic acid
• PYRROLIDIN-2-IMINE HYDROCHLORIDE
• 4-(5-(p-Tolyl)-1,3,4-oxadiazol-2-yl)benzoic acid

4-(5-(P-tolyl)-1,3,4-oxadiazol-2-yl)benzoic acid

CAS: 873208-67-4

4-(5-(P-tolyl)-1,3,4-oxadiazol-2-yl)benzoic acid

Purity: 95%

Molecular weight: 280.28g/mol

Ref: 54-OR87013

4-(5-(P-tolyl)-1,3,4-oxadiazol-2-yl)benzoic acid

CAS: 873208-67-4

Purity: 98%

Molecular weight: 280.2829895019531

Ref: 10-F776736