CAS 87327-65-9

2,6-difluoro-alpha-methylbenzyl alcohol

Description:

2,6-Difluoro-alpha-methylbenzyl alcohol is an organic compound characterized by its unique structure, which includes a benzyl alcohol moiety substituted with two fluorine atoms at the 2 and 6 positions of the aromatic ring, and a methyl group at the alpha position. This compound is typically a colorless to pale yellow liquid with a moderate boiling point and is soluble in organic solvents. The presence of fluorine atoms enhances its chemical stability and can influence its reactivity, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. The hydroxyl (-OH) group in the benzyl alcohol structure contributes to its potential as a hydrogen bond donor, which can affect its interactions in biological systems. Additionally, the compound may exhibit unique physical properties, such as altered melting and boiling points compared to its non-fluorinated counterparts, due to the electronegative nature of fluorine. Overall, 2,6-difluoro-alpha-methylbenzyl alcohol is a compound of interest for its potential applications in synthetic chemistry and material science.

Formula: C₈H₈F₂O

InChI: InChI=1/C8H8F2O/c1-5(11)8-6(9)3-2-4-7(8)10/h2-5,11H,1H3

SMILES: CC(c1c(cccc1F)F)O

Synonyms:

• 1-(2,6-Difluorophenyl)Ethanol

1-(2,6-Difluorophenyl)ethanol, 97%

CAS: 87327-65-9

This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci

Formula: C₈H₈F₂O

Purity: 97%

Color and Shape: Clear colorless to yellow, Liquid

Molecular weight: 158.15

Ref: 02-H32771

1-(2,6-Difluorophenyl)ethanol

CAS: 87327-65-9

Formula: C₈H₈F₂O

Purity: 97%

Color and Shape: Liquid

Molecular weight: 158.1453

Ref: IN-DA003CT5

2,6-Difluoro-α-methylbenzyl alcohol

CAS: 87327-65-9

2,6-Difluoro-α-methylbenzyl alcohol

Purity: 99%

Molecular weight: 158.15g/mol

Ref: 54-PC50008

1-(2,6-Difluorophenyl)ethan-1-ol

CAS: 87327-65-9

Formula: C₈H₈F₂O

Molecular weight: 158.15

Ref: 4Z-E-108012

1-(2,6-Difluorophenyl)ethanol

CAS: 87327-65-9

Purity: 97%

Molecular weight: 158.147995

Ref: 10-F791405