CAS 87327-65-9
:2,6-difluoro-alpha-methylbenzyl alcohol
Description:
2,6-Difluoro-alpha-methylbenzyl alcohol is an organic compound characterized by its unique structure, which includes a benzyl alcohol moiety substituted with two fluorine atoms at the 2 and 6 positions of the aromatic ring, and a methyl group at the alpha position. This compound is typically a colorless to pale yellow liquid with a moderate boiling point and is soluble in organic solvents. The presence of fluorine atoms enhances its chemical stability and can influence its reactivity, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. The hydroxyl (-OH) group in the benzyl alcohol structure contributes to its potential as a hydrogen bond donor, which can affect its interactions in biological systems. Additionally, the compound may exhibit unique physical properties, such as altered melting and boiling points compared to its non-fluorinated counterparts, due to the electronegative nature of fluorine. Overall, 2,6-difluoro-alpha-methylbenzyl alcohol is a compound of interest for its potential applications in synthetic chemistry and material science.
Formula:C8H8F2O
InChI:InChI=1/C8H8F2O/c1-5(11)8-6(9)3-2-4-7(8)10/h2-5,11H,1H3
SMILES:CC(c1c(cccc1F)F)O
Synonyms:- 1-(2,6-Difluorophenyl)Ethanol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-(2,6-Difluorophenyl)ethanol, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C8H8F2OPurity:97%Color and Shape:Clear colorless to yellow, LiquidMolecular weight:158.151-(2,6-Difluorophenyl)ethanol
CAS:Formula:C8H8F2OPurity:97%Color and Shape:LiquidMolecular weight:158.14532,6-Difluoro-α-methylbenzyl alcohol
CAS:2,6-Difluoro-α-methylbenzyl alcohol
Purity:99%Molecular weight:158.15g/mol




