CAS 87330-70-9
:2-aminoethyl pyridine-3-carboxylate dihydrochloride
Description:
2-Aminoethyl pyridine-3-carboxylate dihydrochloride is a chemical compound characterized by its structure, which includes a pyridine ring substituted with an aminoethyl group and a carboxylate functional group. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the dihydrochloride salt form, which enhances its solubility. It is often used in biochemical research and pharmaceutical applications, particularly as a building block in the synthesis of various biologically active molecules. The presence of both amino and carboxylate groups allows for potential interactions in biological systems, making it of interest in medicinal chemistry. Additionally, its dihydrochloride form indicates that it can release hydrochloric acid upon dissolution, which may influence its behavior in different pH environments. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices are followed.
Formula:C8H12Cl2N2O2
InChI:InChI=1/C8H10N2O2.2ClH/c9-3-5-12-8(11)7-2-1-4-10-6-7;;/h1-2,4,6H,3,5,9H2;2*1H
SMILES:c1cc(cnc1)C(=O)OCCN.Cl.Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Nicotinic Acid 2-Aminoethyl Ester Dihydrochloride
CAS:Controlled ProductFormula:C8H10N2O2HClColor and Shape:NeatMolecular weight:239.099
