CAS 873300-63-1

1,2-Dihydro-7-(methylthio)-2-oxo-3-quinolinecarboxaldehyde

Description:

1,2-Dihydro-7-(methylthio)-2-oxo-3-quinolinecarboxaldehyde is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a dihydro form, indicating the presence of two hydrogen atoms that contribute to its saturation. The methylthio group (-S-CH3) attached to the quinoline ring enhances its reactivity and solubility in organic solvents. The presence of the aldehyde functional group (-CHO) indicates that it can participate in various chemical reactions, such as condensation and oxidation. Additionally, the keto group (C=O) contributes to its potential as a ligand in coordination chemistry. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its unique structural features suggest potential applications in synthesizing other complex organic molecules or as a precursor in various chemical reactions. As with many organic compounds, its properties, such as solubility, stability, and reactivity, can be influenced by environmental conditions and the presence of other functional groups.

Formula: C₁₁H₉NO₂S

InChI: InChI=1S/C11H9NO2S/c1-15-9-3-2-7-4-8(6-13)11(14)12-10(7)5-9/h2-6H,1H3,(H,12,14)

InChI key: InChIKey=WHTPQVGRZBWWFK-UHFFFAOYSA-N

SMILES: C(=O)C1=CC=2C(=CC(SC)=CC2)NC1=O

Synonyms:

• 3-Quinolinecarboxaldehyde, 1,2-dihydro-7-(methylthio)-2-oxo-
• 2-Hydroxy-7-(methylsulfanyl)quinoline-3-carbaldehyde
• 1,2-Dihydro-7-(methylthio)-2-oxo-3-quinolinecarboxaldehyde