CAS 873302-38-6
:N-(5-iodo-3-pyridyl)-2,2-dimethyl-propanamide
Description:
N-(5-iodo-3-pyridyl)-2,2-dimethyl-propanamide is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with an iodine atom and an amide functional group. The presence of the iodine atom enhances its reactivity and potential biological activity, making it of interest in medicinal chemistry. The compound features a branched alkyl chain, specifically 2,2-dimethyl-propanamide, which contributes to its steric properties and may influence its interaction with biological targets. This compound is likely to exhibit moderate solubility in organic solvents due to its polar amide group and non-polar hydrocarbon portions. Its molecular structure suggests potential applications in drug development, particularly in the design of compounds targeting specific receptors or enzymes. Additionally, the presence of the pyridine moiety may impart certain pharmacological properties, such as antimicrobial or anti-inflammatory effects. As with many halogenated compounds, safety and handling precautions are essential due to the potential toxicity associated with iodine-containing substances.
Formula:C10H13IN2O
InChI:InChI=1/C10H13IN2O/c1-10(2,3)9(14)13-8-4-7(11)5-12-6-8/h4-6H,1-3H3,(H,13,14)
InChI key:InChIKey=ONCHDNICOXMWJL-UHFFFAOYSA-N
SMILES:N(C(C(C)(C)C)=O)C=1C=C(I)C=NC1
Synonyms:- N-(5-Iodo-3-pyridinyl)-2,2-dimethylpropanamide
- Propanamide, N-(5-iodo-3-pyridinyl)-2,2-dimethyl-
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
