CAS 873302-39-7
:N-(5-bromo-3-pyridyl)-2,2-dimethyl-propanamide
Description:
N-(5-bromo-3-pyridyl)-2,2-dimethyl-propanamide is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with a bromine atom and an amide functional group. The presence of the bromine atom enhances its reactivity and potential biological activity. The compound features a branched alkyl chain, specifically 2,2-dimethyl-propanamide, which contributes to its steric properties and solubility characteristics. This compound is likely to exhibit polar characteristics due to the amide group, which can engage in hydrogen bonding, influencing its solubility in polar solvents. Additionally, the pyridine ring may impart aromatic stability and influence the compound's electronic properties. Such compounds are often of interest in medicinal chemistry and drug development due to their potential pharmacological activities. The CAS number 873302-39-7 serves as a unique identifier for this substance, facilitating its identification in chemical databases and literature. Overall, N-(5-bromo-3-pyridyl)-2,2-dimethyl-propanamide represents a class of compounds with diverse applications in research and industry.
Formula:C10H13BrN2O
InChI:InChI=1/C10H13BrN2O/c1-10(2,3)9(14)13-8-4-7(11)5-12-6-8/h4-6H,1-3H3,(H,13,14)
InChI key:InChIKey=OKUYTVHRBWHVQU-UHFFFAOYSA-N
SMILES:N(C(C(C)(C)C)=O)C=1C=C(Br)C=NC1
Synonyms:- 5-Bromo-3-N-pivaloyl-aminopyridine
- N-(5-Bromo-3-pyridinyl)-2,2-dimethylpropanamide
- N-(5-Bromopyridin-3-yl)-2,2-dimethylpropanamide
- N-(5-Bromopyridin-3-yl)pivalamide
- propanamide, N-(5-bromo-3-pyridinyl)-2,2-dimethyl-
- N-(5-BROMO-PYRIDIN-3-YL)-2,2-DIMETHYL-PROPIONAMIDE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
