CymitQuimica logo

CAS 873383-11-0

:

6-Bromo-1-methylpyridin-2(1H)-one

Description:
6-Bromo-1-methylpyridin-2(1H)-one is a heterocyclic organic compound characterized by its pyridine ring structure, which includes a bromine substituent at the 6-position and a methyl group at the 1-position. This compound features a carbonyl group (C=O) at the 2-position, contributing to its reactivity and potential applications in various chemical reactions. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carbonyl group. The bromine atom introduces notable electrophilic characteristics, making it useful in substitution reactions. Additionally, the compound may display biological activity, which can be explored for pharmaceutical applications. Its CAS number, 873383-11-0, allows for easy identification in chemical databases. As with many brominated compounds, safety precautions should be taken due to potential toxicity and environmental impact. Overall, 6-Bromo-1-methylpyridin-2(1H)-one is a valuable compound in synthetic organic chemistry and medicinal chemistry research.
Formula:C6H6BrNO
InChI:InChI=1S/C6H6BrNO/c1-8-5(7)3-2-4-6(8)9/h2-4H,1H3
InChI key:InChIKey=PUHNNXVBAOPJPW-UHFFFAOYSA-N
SMILES:CN1C(Br)=CC=CC1=O
Synonyms:
  • 2(1)-Pyridone, 6-bromo-1-methyl-
  • 2(1H)-pyridinone, 6-bromo-1-methyl-
  • 6-Bromo-1-methyl-1,2-dihydropyridin-2-one
  • 6-Bromo-1-methyl-2(1H)-pyridinone
  • 6-Bromo-1-methylpyridin-2-one
  • 6-Bromo-N-methylpyridin-2-one
  • 6-Bromo-1-methylpyridin-2(1H)-one
Found 5 products.