CAS 87344-05-6
:Tolmetin glycinamide
Description:
Tolmetin glycinamide is a chemical compound that serves as a derivative of tolmetin, a nonsteroidal anti-inflammatory drug (NSAID) primarily used for its analgesic and anti-inflammatory properties. The compound is characterized by its ability to inhibit cyclooxygenase enzymes, which play a crucial role in the synthesis of prostaglandins, mediators of inflammation and pain. Tolmetin glycinamide is typically presented as a white to off-white crystalline powder, indicating its solid-state at room temperature. Its solubility profile suggests that it is more soluble in organic solvents than in water, which can influence its bioavailability and pharmacokinetics. The compound may exhibit moderate stability under standard conditions, but like many pharmaceuticals, it should be stored in a cool, dry place to maintain its efficacy. Additionally, safety data indicates that, while generally well-tolerated, it may have potential side effects typical of NSAIDs, such as gastrointestinal discomfort or allergic reactions. Overall, tolmetin glycinamide represents a significant compound in the realm of anti-inflammatory medications.
Formula:C17H18N2O4
InChI:InChI=1/C17H18N2O4/c1-11-3-5-12(6-4-11)17(23)14-8-7-13(19(14)2)9-15(20)18-10-16(21)22/h3-8H,9-10H2,1-2H3,(H,18,20)(H,21,22)
SMILES:Cc1ccc(cc1)C(=O)c1ccc(CC(=NCC(=O)O)O)n1C
Synonyms:- N-((1-Methyl-5-(4-methylbenzoyl)-1H-pyrrol-2-yl)acetyl)glycine
- 2-[[2-[1-Methyl-5-(4-methylbenzoyl)pyrrol-2-yl]acetyl]amino]acetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
Amtolmetin
CAS:Controlled ProductApplications Amtolmetin is derived from Tolmetin Sodium Salt Dihydrate (T535350), which is an anti-inflammatory.
References Carson, et al.: J. Med. Chem., 14, 646 (1971), Wong, S., et al.: J. Pharmacol. Exp. Ther., 185, 127 (1973), Brogden, R.N., et al.: Drugs, 15, 429 (1978)Formula:C17H18N2O4Color and Shape:White To Off-WhiteMolecular weight:314.34



