CymitQuimica logo

CAS 873463-80-0

:

Ethanethioic acid, S-[(2-fluorophenyl)methyl] ester

Description:
Ethanethioic acid, S-[(2-fluorophenyl)methyl] ester, also known by its CAS number 873463-80-0, is an organic compound characterized by the presence of a thioester functional group. This compound features a thiocarboxylic acid derivative where the sulfur atom is bonded to an ethyl group and a 2-fluorobenzyl moiety. The presence of the fluorine atom in the aromatic ring can influence the compound's reactivity and polarity, potentially enhancing its biological activity or altering its interaction with other molecules. The thioester functional group is known for its role in various biochemical processes, including acyl transfer reactions. This compound may exhibit properties such as moderate solubility in organic solvents and potential reactivity with nucleophiles due to the electrophilic nature of the carbonyl carbon in the thioester. Its specific applications and behavior would depend on the context of use, such as in synthetic organic chemistry or medicinal chemistry, where it may serve as an intermediate or a building block for more complex molecules.
Formula:C9H9FOS
InChI:InChI=1S/C9H9FOS/c1-7(11)12-6-8-4-2-3-5-9(8)10/h2-5H,6H2,1H3
InChI key:WKJTVRHXVPUHOX-UHFFFAOYSA-N
SMILES:CC(=O)SCC1=CC=CC=C1F
Found 2 products.