CAS 873537-66-7

2-Pyridinemethanol, 5-amino-, dihydrochloride

Description:

2-Pyridinemethanol, 5-amino-, dihydrochloride is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a hydroxymethyl group (-CH2OH) and an amino group (-NH2) attached to the pyridine ring, contributing to its potential as a versatile building block in organic synthesis and medicinal chemistry. The dihydrochloride form indicates that the compound is a salt, typically enhancing its solubility in water and stability. It may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting various diseases. The presence of both the amino and hydroxymethyl groups suggests potential for hydrogen bonding, influencing its reactivity and interaction with biological targets. As with many chemical substances, safety data should be consulted to understand its handling, toxicity, and environmental impact. Overall, 2-Pyridinemethanol, 5-amino-, dihydrochloride represents a compound with significant potential in various chemical and biological applications.

Formula: C₆H₈N₂O·2ClH

InChI: InChI=1S/C6H8N2O.2ClH/c7-5-1-2-6(4-9)8-3-5;;/h1-3,9H,4,7H2;2*1H

InChI key: InChIKey=VODGSNUXWUYBDG-UHFFFAOYSA-N

SMILES: C(O)C1=CC=C(N)C=N1.Cl

Synonyms:

• (5-Amino-pyridin-2-yl)-methanol dihydrochloride
• 2-Pyridinemethanol, 5-amino-, hydrochloride (1:2)
• (5-Aminopyridin-2-yl)methanol dihydrochloride
• 5-Aminopyridine-2-methanol dihydrochloride
• 2-Pyridinemethanol, 5-amino-, dihydrochloride