CymitQuimica logo

CAS 873547-99-0

:

ethyl 2-(2-fluoro-4-methyl-phenyl)-2-oxo-acetate

Description:
Ethyl 2-(2-fluoro-4-methyl-phenyl)-2-oxo-acetate, identified by its CAS number 873547-99-0, is an organic compound characterized by its ester functional group and a substituted aromatic ring. This compound features a fluoro group, which can influence its reactivity and polarity, as well as a methyl group that can affect its steric properties. The presence of the keto group (2-oxo) contributes to its potential reactivity in various chemical reactions, such as nucleophilic additions or condensation reactions. Ethyl esters, in general, are known for their pleasant odors and are often used in flavoring and fragrance applications. Additionally, the specific substitution pattern on the aromatic ring can impart unique electronic properties, making this compound of interest in medicinal chemistry and material science. Its solubility, boiling point, and other physical properties would depend on the molecular interactions of the functional groups present. Overall, this compound exemplifies the complexity and versatility of organic molecules in synthetic chemistry.
Formula:C11H11FO3
InChI:InChI=1/C11H11FO3/c1-3-15-11(14)10(13)8-5-4-7(2)6-9(8)12/h4-6H,3H2,1-2H3
SMILES:CCOC(=O)C(=O)c1ccc(C)cc1F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.