CAS 873551-16-7

4-(1H-Imidazol-4-yl)-1,2,3,6-tetrahydropyridine hydrochloride (1:1)

Description:

4-(1H-Imidazol-4-yl)-1,2,3,6-tetrahydropyridine hydrochloride is a chemical compound characterized by its unique structure, which includes a tetrahydropyridine ring fused with an imidazole moiety. This compound typically appears as a white to off-white solid and is soluble in water and various organic solvents, making it versatile for different applications. The presence of the hydrochloride indicates that it is a salt form, which often enhances its stability and solubility. This compound may exhibit biological activity, potentially serving as a pharmacological agent or a building block in medicinal chemistry. Its molecular structure suggests that it could interact with biological targets, possibly influencing neurotransmitter systems or other cellular pathways. As with many nitrogen-containing heterocycles, it may also participate in coordination chemistry or serve as a ligand in metal complexes. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₈H₁₂ClN₃

InChI: InChI=1/C8H11N3.ClH/c1-3-9-4-2-7(1)8-5-10-6-11-8;/h1,5-6,9H,2-4H2,(H,10,11);1H

SMILES: C1=C(CCNC1)c1cnc[nH]1.Cl