CymitQuimica logo

CAS 873566-75-7

:

(3-amino-4-fluorophenyl)boronic acid

Description:
(3-Amino-4-fluorophenyl)boronic acid is an organic compound characterized by the presence of both an amino group and a boronic acid functional group attached to a phenyl ring. The molecular structure features a fluorine atom at the para position relative to the amino group, which can influence its reactivity and solubility. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the boronic acid group. It is often utilized in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to form reversible covalent bonds with diols. The boronic acid moiety also plays a crucial role in cross-coupling reactions, such as Suzuki-Miyaura coupling, making it valuable in the synthesis of complex organic molecules. Additionally, the presence of the amino and fluorine substituents can enhance its biological activity and selectivity in various applications.
Formula:C6H7BFNO2
InChI:InChI=1/C6H7BFNO2/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3,10-11H,9H2
InChI key:SYBMNJPUZMUPGQ-UHFFFAOYSA-N
SMILES:c1cc(c(cc1B(O)O)N)F
Synonyms:
  • boronic acid, B-(3-amino-4-fluorophenyl)-
  • 3-Amino-4-fluorophenylboronicacid
  • 3-Amino-4-fluorophenylboronic acid, pinacol ester
Found 4 products.