CAS 87357-67-3
:(3R)-3-(benzyloxy)tetradecanoic acid
Description:
(3R)-3-(benzyloxy)tetradecanoic acid, with the CAS number 87357-67-3, is a fatty acid derivative characterized by a long hydrocarbon chain and a benzyloxy functional group. This compound features a tetradecanoic acid backbone, which consists of 14 carbon atoms, making it a medium-chain fatty acid. The presence of the benzyloxy group introduces an aromatic ring into the structure, enhancing its chemical properties and potential applications. The stereochemistry indicated by the (3R) designation suggests that the hydroxyl group is oriented in a specific spatial arrangement, which can influence the compound's reactivity and interactions with biological systems. This substance may exhibit amphiphilic characteristics, allowing it to interact with both hydrophilic and hydrophobic environments, making it potentially useful in various applications, including pharmaceuticals, surfactants, and as a biochemical probe. Its unique structure may also contribute to specific biological activities, although detailed studies would be necessary to elucidate its full range of properties and potential uses.
Formula:C21H34O3
InChI:InChI=1/C21H34O3/c1-2-3-4-5-6-7-8-9-13-16-20(17-21(22)23)24-18-19-14-11-10-12-15-19/h10-12,14-15,20H,2-9,13,16-18H2,1H3,(H,22,23)/t20-/m1/s1
SMILES:CCCCCCCCCCC[C@H](CC(=O)O)OCc1ccccc1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
(R)-3-(Benzyloxy)tetradecanoic acid
CAS:(R)-3-(Benzyloxy)tetradecanoic acidPurity:95%Molecular weight:334.5g/molR-(3)-Benzyloxy myristic acid
CAS:R-(3)-Benzyloxy myristic acid is an adjuvant that is used in vaccines. It is a synthetic molecule with the ability to activate antigen-specific CD4 and CD8 T-cells. R-(3)-Benzyloxy myristic acid has been shown to be an efficient method of enhancing antigen-specific antibody production by stimulating dendritic cells. This agent is also pH sensitive and can be used as a vaccine adjuvant at acidic pH values, which are found in the stomach. R-(3)-Benzyloxy myristic acid has been shown to stimulate T-cell proliferation and increase the expression of co-stimulatory molecules on these cells, increasing the efficiency of immunization.
Formula:C21H34O3Purity:Min. 95%Molecular weight:334.49 g/mol

