CAS 87362-28-5

2-Pyrimidinecarboxylicacid, hydrazide

Description:

2-Pyrimidinecarboxylic acid hydrazide, with the CAS number 87362-28-5, is an organic compound characterized by its hydrazide functional group attached to a pyrimidine ring. This compound typically appears as a solid and is soluble in polar solvents, reflecting its hydrophilic nature due to the presence of the carboxylic acid and hydrazide groups. It is often utilized in pharmaceutical and agricultural chemistry for its potential biological activities, including antimicrobial and anti-inflammatory properties. The presence of the pyrimidine moiety contributes to its ability to interact with biological targets, making it a subject of interest in drug development. Additionally, the compound may exhibit various reactivity patterns typical of hydrazides, such as forming hydrazones or undergoing condensation reactions. Its stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 2-Pyrimidinecarboxylic acid hydrazide is a versatile compound with applications in medicinal chemistry and research.

Formula: C₅H₆N₄O

InChI: InChI=1S/C5H6N4O/c6-9-5(10)4-7-2-1-3-8-4/h1-3H,6H2,(H,9,10)

InChI key: DQEIYNHQKWEZKR-UHFFFAOYSA-N

SMILES: C1=CN=C(N=C1)C(=O)NN

Synonyms:

• 2-Pyrimidinecarboxylic acid, hydrazide (9CI)

Pyrimidine-2-carbohydrazide

CAS: 87362-28-5

Pyrimidine-2-carbohydrazide

Formula: C₅H₆N₄O

Purity: 95%

Molecular weight: 138.13

Ref: 54-OR1003751

Pyrimidine-2-carbohydrazide

CAS: 87362-28-5

Formula: C₅H₆N₄O

Purity: 97%

Color and Shape: Solid

Molecular weight: 138.1273

Ref: IN-DA004O1Y

Pyrimidine-2-carbohydrazide

CAS: 87362-28-5

Formula: C₅H₆N₄O

Purity: 97%

Color and Shape: Solid

Molecular weight: 138.13

Ref: 10-F068715

Pyrimidine-2-carbohydrazide

CAS: 87362-28-5

Pyrimidine-2-carbohydrazide is a bioinorganic compound that has been shown to be active against bacteria, including staphylococcus. It is also effective against tuberculosis and leishmania. Pyrimidine-2-carbohydrazide binds to the bacterial cell membrane and inhibits its growth by preventing the synthesis of essential proteins. This drug's pharmacokinetic properties have been studied using techniques such as bioinorganic and electron paramagnetic resonance spectroscopy. The tetranuclear nature of pyrimidine-2-carbohydrazide makes it an excellent candidate for use with ciprofloxacin in the treatment of leishmaniasis.

Formula: C₅H₆N₄O

Purity: Min. 95%

Molecular weight: 138.13 g/mol

Ref: 3D-MDA36228