CAS 87362-29-6

5-Chloro-2-pyrimidinecarboxylic acid hydrazide

Description:

5-Chloro-2-pyrimidinecarboxylic acid hydrazide is a chemical compound characterized by its pyrimidine ring structure, which includes a chlorine substituent at the 5-position and a hydrazide functional group. This compound typically appears as a solid and is soluble in polar solvents, reflecting its hydrophilic nature due to the presence of the carboxylic acid and hydrazide groups. It is often utilized in pharmaceutical and agricultural chemistry for its potential biological activities, including antimicrobial and herbicidal properties. The presence of the chlorine atom can enhance the compound's reactivity and influence its interaction with biological targets. Additionally, the hydrazide moiety can participate in various chemical reactions, making it a versatile intermediate in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity. Overall, 5-Chloro-2-pyrimidinecarboxylic acid hydrazide is a significant compound in research and development within the fields of medicinal and agricultural chemistry.

Formula: C₅H₅ClN₄O

InChI: InChI=1S/C5H5ClN4O/c6-3-1-8-4(9-2-3)5(11)10-7/h1-2H,7H2,(H,10,11)

InChI key: InChIKey=QGTAMGAMKVZDCQ-UHFFFAOYSA-N

SMILES: C(NN)(=O)C=1N=CC(Cl)=CN1

Synonyms:

• 5-Chloro-2-pyrimidinecarboxylic acid hydrazide
• 2-Pyrimidinecarboxylic acid, 5-chloro-, hydrazide