CymitQuimica logo

CAS 873663-50-4

:

3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-benzenediamine

Description:
3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-benzenediamine, with the CAS number 873663-50-4, is an organic compound characterized by the presence of both a boron-containing dioxaborolane moiety and an aromatic amine structure. This compound typically exhibits properties associated with both functional groups, including potential reactivity in cross-coupling reactions, which are valuable in synthetic organic chemistry. The dioxaborolane group enhances the compound's stability and solubility in organic solvents, while the amine functionality can participate in hydrogen bonding and nucleophilic reactions. The presence of multiple methyl groups contributes to steric hindrance, which can influence the compound's reactivity and interaction with other molecules. Additionally, this compound may exhibit specific optical properties due to its aromatic structure, making it of interest in materials science and medicinal chemistry. Overall, its unique structural features make it a versatile building block for various chemical applications, particularly in the development of pharmaceuticals and advanced materials.
Formula:C12H19BN2O2
InChI:InChI=1S/C12H19BN2O2/c1-11(2)12(3,4)17-13(16-11)8-6-5-7-9(14)10(8)15/h5-7H,14-15H2,1-4H3
InChI key:InChIKey=YIPXXWWEXMOZPZ-UHFFFAOYSA-N
SMILES:NC1=C(B2OC(C)(C)C(C)(C)O2)C=CC=C1N
Synonyms:
  • 3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-benzenediamine
  • 1,2-Benzenediamine, 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
  • 3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzene-1,2-diamine
  • 2-Amino-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline
Found 5 products.