CAS 87368-00-1
:N-(hexahydrocyclopenta[c]pyrrol-2(1H)-ylcarbamoyl)-4-(hydroxymethyl)benzenesulfonamide
Description:
N-(hexahydrocyclopenta[c]pyrrol-2(1H)-ylcarbamoyl)-4-(hydroxymethyl)benzenesulfonamide, with the CAS number 87368-00-1, is a chemical compound characterized by its complex structure, which includes a sulfonamide group, a hydroxymethyl group, and a cyclic amine moiety. This compound typically exhibits properties associated with sulfonamides, such as potential antibacterial activity, due to the presence of the sulfonamide functional group. The cyclic structure contributes to its unique steric and electronic properties, which may influence its biological activity and solubility. The presence of the hydroxymethyl group can enhance its reactivity and interaction with biological targets. Additionally, the compound may exhibit moderate to high polarity, affecting its solubility in various solvents. Its specific applications and efficacy would depend on further studies, including pharmacological evaluations and structure-activity relationship analyses. Overall, this compound represents a class of molecules that may have potential therapeutic uses, particularly in medicinal chemistry.
Formula:C15H21N3O4S
InChI:InChI=1/C15H21N3O4S/c19-10-11-4-6-14(7-5-11)23(21,22)17-15(20)16-18-8-12-2-1-3-13(12)9-18/h4-7,12-13,19H,1-3,8-10H2,(H2,16,17,20)
SMILES:C1CC2CN(CC2C1)N=C(NS(=O)(=O)c1ccc(cc1)CO)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
Hydroxy Gliclazide
CAS:Formula:C15H21N3O4SColor and Shape:White To Off-White SolidMolecular weight:339.42Gastrodin Impurity 9
CAS:Formula:C15H20O8Color and Shape:White To Off-White SolidMolecular weight:328.32Hydroxy Gliclazide
CAS:Controlled ProductApplications The major hydroxylated metabolite of Gliclazide (G409875).
References Miyazaki, H., et al.: Eur. J. Drug Metab. Pharmacokinet., 8, 117 (1983), Rieutord, A., et al.: Xenobiotica, 25, 1345 (1995),Formula:C15H21N3O4SColor and Shape:NeatMolecular weight:339.41


