CymitQuimica logo

CAS 873697-59-7

:

tert-butyl 4-[(3-amino-5-fluoro-phenyl)methyl]piperazine-1-carboxylate

Description:
Tert-butyl 4-[(3-amino-5-fluoro-phenyl)methyl]piperazine-1-carboxylate is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a tert-butyl ester group, enhancing its lipophilicity and potentially influencing its pharmacokinetic properties. The presence of a 3-amino-5-fluorophenyl group suggests that it may exhibit biological activity, possibly as a pharmaceutical agent, due to the amino and fluorine substituents that can affect binding interactions with biological targets. The carboxylate functional group indicates that it can participate in various chemical reactions, including esterification and amidation. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of drugs targeting specific receptors or enzymes. The compound's solubility, stability, and reactivity will depend on its specific molecular interactions and the environment in which it is used. Overall, this compound represents a versatile scaffold for further chemical modifications and biological evaluations.
Formula:C16H24FN3O2
InChI:InChI=1/C16H24FN3O2/c1-16(2,3)22-15(21)20-6-4-19(5-7-20)11-12-8-13(17)10-14(18)9-12/h8-10H,4-7,11,18H2,1-3H3
SMILES:CC(C)(C)OC(=O)N1CCN(CC1)Cc1cc(cc(c1)N)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.