CAS 873697-69-9
:3-Amino-2-fluorobenzaldehyde
Description:
3-Amino-2-fluorobenzaldehyde is an organic compound characterized by the presence of an amino group (-NH2) and a fluorine atom attached to a benzaldehyde structure. This compound features a benzene ring with a formyl group (-CHO) and an amino group positioned at the meta position relative to the aldehyde, along with a fluorine substituent at the ortho position. The presence of the amino group imparts basic properties, while the aldehyde group contributes to its reactivity, particularly in nucleophilic addition reactions. The fluorine atom enhances the compound's electrophilicity and can influence its solubility and reactivity in various chemical environments. 3-Amino-2-fluorobenzaldehyde is often utilized in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to serve as a building block for more complex molecules. Its unique combination of functional groups allows for diverse chemical transformations, making it a valuable compound in synthetic organic chemistry.
Formula:C7H6FNO
InChI:InChI=1S/C7H6FNO/c8-7-5(4-10)2-1-3-6(7)9/h1-4H,9H2
InChI key:InChIKey=IQICCYBHVPARCV-UHFFFAOYSA-N
SMILES:C(=O)C1=C(F)C(N)=CC=C1
Synonyms:- Benzaldehyde, 3-amino-2-fluoro-
- 3-Amino-2-fluorobenzaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.