CAS 87376-16-7
:pyrrolomycin E
Description:
Pyrrolomycin E is a naturally occurring antibiotic belonging to the pyrrolomycin class of compounds, which are known for their antibacterial properties. It is produced by certain strains of the bacterium *Streptomyces*. The chemical structure of pyrrolomycin E features a complex bicyclic framework, which contributes to its biological activity. This compound exhibits a broad spectrum of activity against various Gram-positive bacteria, making it of interest in the field of medicinal chemistry and antibiotic research. Pyrrolomycin E operates through mechanisms that may involve interference with bacterial protein synthesis or cell wall synthesis, although specific modes of action can vary. Its potential applications in treating bacterial infections are being explored, particularly in the context of rising antibiotic resistance. Additionally, the compound's stability, solubility, and pharmacokinetic properties are important factors that influence its efficacy and therapeutic potential. As research continues, pyrrolomycin E may provide insights into developing new antibiotics or enhancing existing treatments against resistant bacterial strains.
Formula:C10H5Cl3N2O3
InChI:InChI=1/C10H5Cl3N2O3/c11-4-1-5(10(16)6(12)2-4)9-7(15(17)18)3-8(13)14-9/h1-3,14,16H
Synonyms:- 2,4-Dichloro-6-(5-chloro-3-nitro-1H-pyrrol-2-yl)phenol
- Phenol, 2,4-dichloro-6-(5-chloro-3-nitro-1H-pyrrol-2-yl)-
- pyrrolomycin E
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Pyrrolomycin E
CAS:Pyrrolomycin E is a pyrrole-based antibiotic with activity against Gram-positive bacteria, Gram-negative bacteria, and fungi.Formula:C10H5Cl3N2O3Color and Shape:SolidMolecular weight:307.517
