CAS 873779-32-9

Phenylmethyl 3,4-dihydro-4-oxospiro[2H-1-benzopyran-2,4′-piperidine]-1′-carboxylate

Description:

Phenylmethyl 3,4-dihydro-4-oxospiro[2H-1-benzopyran-2,4′-piperidine]-1′-carboxylate, identified by its CAS number 873779-32-9, is a synthetic organic compound characterized by its complex molecular structure, which includes a spirocyclic framework. This compound features a benzopyran moiety, which is known for its presence in various natural products and its potential biological activities. The presence of a piperidine ring contributes to its pharmacological properties, making it of interest in medicinal chemistry. The carboxylate functional group suggests potential for reactivity and interactions in biological systems. Generally, compounds of this nature may exhibit a range of activities, including anti-inflammatory, antioxidant, or anticancer properties, although specific biological data would be necessary to confirm these effects. Its solubility, stability, and reactivity would depend on the specific conditions, such as pH and solvent, making it essential to consider these factors in practical applications. Overall, this compound represents a fascinating area of study within the field of organic and medicinal chemistry.

Formula: C₂₁H₂₁NO₄

InChI: InChI=1S/C21H21NO4/c23-18-14-21(26-19-9-5-4-8-17(18)19)10-12-22(13-11-21)20(24)25-15-16-6-2-1-3-7-16/h1-9H,10-15H2

InChI key: InChIKey=AOOOWMISCJTQSP-UHFFFAOYSA-N

SMILES: O=C1CC2(OC=3C1=CC=CC3)CCN(C(OCC4=CC=CC=C4)=O)CC2

Synonyms:

• Phenylmethyl 3,4-dihydro-4-oxospiro[2H-1-benzopyran-2,4′-piperidine]-1′-carboxylate
• Spiro[2H-1-benzopyran-2,4′-piperidine]-1′-carboxylic acid, 3,4-dihydro-4-oxo-, phenylmethyl ester

BENZYL 4-OXOSPIRO[CHROMAN-2,4'-PIPERIDINE]-1'-CARBOXYLATE

CAS: 873779-32-9

Purity: 95.0%

Molecular weight: 351.4020080566406

Ref: 10-F529214