CAS 873788-09-1
:1-butyl-3-(pyridin-2-ylmethyl)-1H-imidazol-3-ium hexafluorophosphate
Description:
1-Butyl-3-(pyridin-2-ylmethyl)-1H-imidazol-3-ium hexafluorophosphate is an ionic liquid characterized by its unique structure, which includes a butyl group and a pyridine moiety attached to an imidazolium core. This compound typically exhibits properties such as high thermal stability, low volatility, and good solubility in various solvents, making it suitable for applications in organic synthesis, electrochemistry, and as a solvent for various chemical reactions. The hexafluorophosphate anion contributes to its ionic nature, enhancing its conductivity and making it a potential candidate for use in electrochemical devices. Additionally, the presence of the butyl group provides hydrophobic characteristics, while the pyridine ring can participate in coordination chemistry, potentially influencing the reactivity and interaction with other chemical species. Overall, this compound represents a class of ionic liquids that are gaining attention for their environmentally friendly properties and versatility in various chemical applications.
Formula:C13H18F6N3P
InChI:InChI=1/C13H18N3.F6P/c1-2-3-8-15-9-10-16(12-15)11-13-6-4-5-7-14-13;1-7(2,3,4,5)6/h4-7,9-10,12H,2-3,8,11H2,1H3;/q+1;-1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.