CymitQuimica logo

CAS 873790-29-5

:

2-Chloro-N-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-N-(1-methylethyl)acetamide

Description:
2-Chloro-N-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-N-(1-methylethyl)acetamide, with CAS number 873790-29-5, is a synthetic organic compound characterized by its complex structure, which includes a chloro group, an oxadiazole moiety, and an acetamide functional group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of the oxadiazole ring suggests potential applications in medicinal chemistry, particularly in the development of antimicrobial or anti-inflammatory agents. Its molecular structure may contribute to specific interactions with biological targets, influencing its efficacy and safety profile. As with many synthetic compounds, understanding its stability, reactivity, and interaction with other substances is crucial for its application in various fields, including drug development and agrochemicals. Safety data and handling precautions should be observed due to the presence of chlorine and other reactive functional groups.
Formula:C14H15Cl2N3O2
InChI:InChI=1S/C14H15Cl2N3O2/c1-9(2)19(13(20)7-15)8-12-17-18-14(21-12)10-5-3-4-6-11(10)16/h3-6,9H,7-8H2,1-2H3
InChI key:InChIKey=KZQZHZHQFYJXQX-UHFFFAOYSA-N
SMILES:ClC1=C(C=2OC(CN(C(CCl)=O)C(C)C)=NN2)C=CC=C1
Synonyms:
  • 2-Chloro-N-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-N-(1-methylethyl)acetamide
  • Acetamide, 2-chloro-N-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-N-(1-methylethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.