CAS 873790-31-9

2-Chloro-1-[2,5-dimethyl-1-(2-pyridinyl)-1H-pyrrol-3-yl]ethanone

Description:

2-Chloro-1-[2,5-dimethyl-1-(2-pyridinyl)-1H-pyrrol-3-yl]ethanone, identified by its CAS number 873790-31-9, is a synthetic organic compound characterized by its complex structure, which includes a chloro group, a ketone functional group, and a pyrrole ring substituted with a pyridine moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and stability. The presence of the chloro substituent may enhance its electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions. The dimethyl substitution on the pyrrole ring can influence its steric and electronic properties, potentially affecting its biological activity. This compound may be of interest in medicinal chemistry and drug development due to its unique structural features, which could impart specific pharmacological effects. As with many organic compounds, its solubility, melting point, and boiling point would depend on the specific conditions and solvents used. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₃H₁₃ClN₂O

InChI: InChI=1S/C13H13ClN2O/c1-9-7-11(12(17)8-14)10(2)16(9)13-5-3-4-6-15-13/h3-7H,8H2,1-2H3

InChI key: InChIKey=DGAMRZNHAPAAPS-UHFFFAOYSA-N

SMILES: CC=1N(C(C)=CC1C(CCl)=O)C2=CC=CC=N2

Synonyms:

• Ethanone, 2-chloro-1-[2,5-dimethyl-1-(2-pyridinyl)-1H-pyrrol-3-yl]-
• 2-Chloro-1-[2,5-dimethyl-1-(2-pyridinyl)-1H-pyrrol-3-yl]ethanone
• 2-Chloro-1-[2,5-dimethyl-1-(pyridin-2-yl)-1H-pyrrol-3-yl]ethan-1-one