CymitQuimica logo

CAS 87384-00-7

:

Dimethyl isopropylidenesuccinate

Description:
Dimethyl isopropylidenesuccinate, with the CAS number 87384-00-7, is an organic compound characterized by its ester functional groups and a unique structure that includes a succinate backbone. This compound typically appears as a colorless to pale yellow liquid and is known for its relatively low volatility. It is soluble in organic solvents, making it useful in various chemical applications. The presence of the isopropylidene group contributes to its stability and reactivity, particularly in organic synthesis. Dimethyl isopropylidenesuccinate can participate in reactions such as esterification and transesterification, which are valuable in the production of polymers and other complex organic molecules. Additionally, it may exhibit moderate toxicity, necessitating appropriate handling and safety precautions in laboratory and industrial settings. Its applications can extend to fields such as pharmaceuticals, agrochemicals, and materials science, where it serves as an intermediate or building block in the synthesis of more complex compounds.
Formula:C9H14O4
InChI:InChI=1/C9H14O4/c1-6(2)7(9(11)13-4)5-8(10)12-3/h5H2,1-4H3
SMILES:CC(=C(CC(=O)OC)C(=O)OC)C
Synonyms:
  • Dimethyl 2-(1-Methylethylidene)Butanedioate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.