CAS 87388-06-5

4-(2,4-Dichlorophenyl)-1H-pyrrole-3-carbonitrile

Description:

4-(2,4-Dichlorophenyl)-1H-pyrrole-3-carbonitrile, with the CAS number 87388-06-5, is a chemical compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. This compound features a dichlorophenyl group, indicating the presence of two chlorine atoms on a phenyl ring, which contributes to its chemical reactivity and potential biological activity. The carbonitrile functional group (-C≡N) attached to the pyrrole enhances its polarity and can influence its solubility in various solvents. Typically, compounds like this may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry and drug development. The presence of halogens, such as chlorine, often affects the compound's lipophilicity and metabolic stability. Additionally, the structural features suggest potential applications in agrochemicals or as intermediates in organic synthesis. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or environmental impact.

Formula: C₁₁H₆Cl₂N₂

InChI: InChI=1/C11H6Cl2N2/c12-8-1-2-9(11(13)3-8)10-6-15-5-7(10)4-14/h1-3,5-6,15H

SMILES: c1cc(c2c[nH]cc2C#N)c(cc1Cl)Cl

Synonyms:

• 1H-pyrrole-3-carbonitrile, 4-(2,4-dichlorophenyl)-
• 4-(2,4-Dichlorophenyl)-1H-pyrrole-3-carbonitrile