CAS 873913-87-2

6-chloro-2,3-diphenylimidazo[1,2-b]pyridazine

Description:

6-Chloro-2,3-diphenylimidazo[1,2-b]pyridazine is a heterocyclic compound characterized by its complex structure, which includes an imidazo[1,2-b]pyridazine core fused with two phenyl groups and a chlorine substituent at the 6-position. This compound typically exhibits properties associated with heterocycles, such as potential biological activity and varied solubility depending on the solvent used. The presence of the chlorine atom can influence its reactivity and interaction with biological targets, potentially enhancing its pharmacological properties. Additionally, the diphenyl substitution may contribute to its stability and lipophilicity, making it suitable for various applications in medicinal chemistry. The compound's unique structure may also allow for specific interactions with enzymes or receptors, making it a candidate for further research in drug development. As with many heterocyclic compounds, its synthesis and characterization are crucial for understanding its potential uses and mechanisms of action in biological systems.

Formula: C₁₈H₁₂ClN₃

InChI: InChI=1/C18H12ClN3/c19-15-11-12-16-20-17(13-7-3-1-4-8-13)18(22(16)21-15)14-9-5-2-6-10-14/h1-12H

SMILES: c1ccc(cc1)c1c(c2ccccc2)n2c(ccc(Cl)n2)n1

Synonyms:

• 6-Chlor-2,3-diphenylimidazo[1,2-b]pyridazin
• Imidazo[1,2-B]Pyridazine, 6-Chloro-2,3-Diphenyl-