CAS 87392-05-0
:(R)-tetrahydrofuran-2-carboxylic acid
Description:
(R)-tetrahydrofuran-2-carboxylic acid is a chiral organic compound characterized by its tetrahydrofuran ring structure, which is a five-membered cyclic ether. The presence of a carboxylic acid functional group (-COOH) at the 2-position of the tetrahydrofuran ring imparts acidic properties to the molecule. This compound is typically colorless to pale yellow and is soluble in polar solvents such as water and alcohols due to its ability to form hydrogen bonds. Its chirality, indicated by the (R) configuration, suggests that it can exhibit different biological activities compared to its enantiomer. (R)-tetrahydrofuran-2-carboxylic acid is of interest in various fields, including pharmaceuticals and organic synthesis, where it may serve as an intermediate or building block for more complex molecules. Additionally, its unique structure allows for potential applications in the development of chiral catalysts or ligands in asymmetric synthesis. As with many carboxylic acids, it may also participate in various chemical reactions, including esterification and decarboxylation.
Formula:C5H8O3
InChI:InChI=1/C5H8O3/c6-5(7)4-2-1-3-8-4/h4H,1-3H2,(H,6,7)/t4-/m1/s1
SMILES:C1C[C@H](C(=O)O)OC1
Synonyms:- R-Thfc
- (R)-(+)-2-Tetrahydrofuroic acid
- (R)-(+)-Tetrahydro-2-furoic acid
- Faropenem,Fropenem
- Rctf
- (R)-(+)-2-Carboxy tetrahydrofuroic acid
- 2-Furancarboxylicacid,tetrahydro-,(2R)
- (2R)-tetrahydrofuran-2-carboxylic acid
- (2R)-tetrahydrofuran-2-carboxylate
- (2S)-tetrahydrofuran-2-carboxylate
- (R)-(+)-Tetrahydrofuran-2-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
(R)-(+)-Tetrahydro-2-furoic acid, 98+%, ee 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C5H8O3Purity:98%Color and Shape:liquid, Clear, colourlessMolecular weight:116.12(R)-(+)-Tetrahydrofuran-2-carboxylic acid
CAS:Formula:C5H8O3Purity:98%Color and Shape:LiquidMolecular weight:116.1152(R)-(+)-2-Tetrahydrofuroic acid
CAS:(R)-(+)-2-Tetrahydrofuroic acidPurity:98%Molecular weight:116.12g/mol(R)-(+)-Tetrahydrofuran-2-carboxylic Acid
CAS:Formula:C5H8O3Purity:>98.0%(GC)(T)Color and Shape:Colorless to Light yellow clear liquidMolecular weight:116.12D-Tetrahydro-furan-2-carboxylic acid
CAS:Formula:C5H8O3Purity:95%Color and Shape:LiquidMolecular weight:116.116






