CAS 873928-71-3

2-[[bis(trideuteriomethyl)amino]methyl]cyclohexanone

Description:

2-[[Bis(trideuteriomethyl)amino]methyl]cyclohexanone is a chemical compound characterized by its unique structure, which includes a cyclohexanone ring and a bis(trideuteriomethyl)amino group. The presence of deuterium, a stable isotope of hydrogen, in the trideuteriomethyl groups indicates that this compound is likely used in studies requiring isotopic labeling, such as NMR spectroscopy or metabolic tracing. The cyclohexanone moiety contributes to the compound's potential reactivity, particularly in nucleophilic addition reactions due to the carbonyl group. This compound may exhibit specific physical properties, such as solubility in organic solvents and distinct boiling and melting points, influenced by its molecular structure and the presence of deuterium. Additionally, the compound's stability and reactivity can be affected by the steric and electronic effects of the substituents. Overall, 2-[[bis(trideuteriomethyl)amino]methyl]cyclohexanone serves as a valuable tool in various chemical and biochemical applications, particularly in research settings.

Formula: C₉H₁₁D₆NO

InChI: InChI=1/C9H17NO/c1-10(2)7-8-5-3-4-6-9(8)11/h8H,3-7H2,1-2H3/i1D3,2D3

SMILES: C(N(C([2H])([2H])[2H])CC1CCCCC1=O)([2H])([2H])[2H]

2-(Bismethyl)aminomethylcyclohexanone-d6

Controlled Product

CAS: 873928-71-3

Applications An impurity found in tramadol (T712500).
References Medvedovici, A. et al.: J. Pharmac. Biomed. Anal., 34, 67 (2004);

Formula: C₉₂H₆H₁₁NO

Color and Shape: Neat

Molecular weight: 161.27

Ref: TR-B585450