CAS 873945-31-4
:(3R,4R,5S)-4-(4-Hydroxyphenyl)-5-[[tris(1-methylethyl)silyl]oxy]-3-piperidinol
Description:
The chemical substance known as (3R,4R,5S)-4-(4-Hydroxyphenyl)-5-[[tris(1-methylethyl)silyl]oxy]-3-piperidinol, with the CAS number 873945-31-4, is characterized by its complex molecular structure, which includes a piperidine ring and a hydroxyphenyl group. The presence of the tris(1-methylethyl)silyl group indicates that it has significant hydrophobic characteristics, which can influence its solubility and reactivity. The stereochemistry, denoted by the (3R,4R,5S) configuration, suggests specific spatial arrangements of its atoms, which can affect its biological activity and interactions with other molecules. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential interactions with biological targets. Additionally, the presence of functional groups such as the hydroxy and silyl groups may impart unique chemical reactivity, making it a subject of interest in synthetic organic chemistry and materials science. Overall, this compound's structural features contribute to its potential applications in various fields, including drug development and materials engineering.
Formula:C20H35NO3Si
InChI:InChI=1S/C20H35NO3Si/c1-13(2)25(14(3)4,15(5)6)24-19-12-21-11-18(23)20(19)16-7-9-17(22)10-8-16/h7-10,13-15,18-23H,11-12H2,1-6H3/t18-,19+,20+/m0/s1
InChI key:InChIKey=XHWBYYAUFKGLBF-XUVXKRRUSA-N
SMILES:O([Si](C(C)C)(C(C)C)C(C)C)[C@H]1[C@@H]([C@@H](O)CNC1)C2=CC=C(O)C=C2
Synonyms:- 3-Piperidinol, 4-(4-hydroxyphenyl)-5-[[tris(1-methylethyl)silyl]oxy]-, (3R,4R,5S)-
- (3R,4R,5S)-4-(4-Hydroxyphenyl)-5-[[tris(1-methylethyl)silyl]oxy]-3-piperidinol
- (3R,4R,5S)-4-(4-Hydroxyphenyl)-5-(triisopropylsilanyloxy)piperidin-3-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.