CymitQuimica logo

CAS 874-19-1

:

4-Piperidinone, 1,3,5-trimethyl-, hydrochloride (1:1)

Description:
4-Piperidinone, 1,3,5-trimethyl-, hydrochloride (1:1), with CAS number 874-19-1, is a chemical compound characterized by its piperidinone structure, which includes a six-membered ring containing nitrogen. This compound features three methyl groups attached to the piperidinone, contributing to its unique properties. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in water and makes it suitable for various applications in pharmaceuticals and organic synthesis. The presence of the piperidinone moiety suggests potential biological activity, often associated with central nervous system effects. Its molecular structure allows for interactions with various biological targets, making it of interest in medicinal chemistry. Additionally, the compound's stability and reactivity can be influenced by the presence of the hydrochloride group, which can affect its behavior in different chemical environments. Safety data should be consulted for handling and usage, as with all chemical substances, to ensure proper precautions are taken.
Formula:C8H15NO·ClH
InChI:InChI=1S/C8H15NO.ClH/c1-6-4-9(3)5-7(2)8(6)10;/h6-7H,4-5H2,1-3H3;1H
InChI key:InChIKey=TXNCKFAPNMKQCS-UHFFFAOYSA-N
SMILES:O=C1C(C)CN(C)CC1C.Cl
Synonyms:
  • 4-Piperidone, 1,3,5-trimethyl-, hydrochloride
  • 4-Piperidinone, 1,3,5-trimethyl-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.