CAS 874-81-7
:Pyridinium, 1-butyl-, iodide (1:1)
Description:
Pyridinium, 1-butyl-, iodide (1:1), commonly referred to as butylpyridinium iodide, is a quaternary ammonium salt characterized by its pyridinium cation and iodide anion. It typically appears as a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols, owing to its ionic nature. The compound exhibits hygroscopic properties, meaning it can absorb moisture from the air. Its structure consists of a pyridine ring substituted with a butyl group, which contributes to its lipophilicity and potential applications in various fields, including organic synthesis and as a phase transfer catalyst. Butylpyridinium iodide can also serve as a surfactant due to its amphiphilic characteristics. In terms of safety, it is essential to handle this compound with care, as quaternary ammonium salts can be irritants and may pose environmental hazards. Overall, butylpyridinium iodide is a versatile compound with significant utility in chemical research and industrial applications.
Formula:C9H14IN
InChI:InChI=1S/C9H14N.HI/c1-2-3-7-10-8-5-4-6-9-10;/h4-6,8-9H,2-3,7H2,1H3;1H/q+1;/p-1
InChI key:InChIKey=FMCBAAMDKQPYKZ-UHFFFAOYSA-M
SMILES:C(CCC)[N+]=1C=CC=CC1.[I-]
Synonyms:- Pyridinium, 1-butyl-, iodide (1:1)
- Pyridinium, 1-butyl-, iodide
- 1-BUTYLPYRIDINIUM IODIDE
- N-Butylpyridinium iodide
- 1-Butylpyridinium iodide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
