CAS 874-87-3
:4-(Methylthio)benzyl chloride
Description:
4-(Methylthio)benzyl chloride, with the CAS number 874-87-3, is an organic compound characterized by the presence of a benzyl chloride moiety substituted with a methylthio group at the para position. This compound typically appears as a colorless to pale yellow liquid and has a distinct aromatic odor. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic nature. The presence of the methylthio group imparts unique reactivity, making it useful in various chemical syntheses, particularly in the formation of thioether compounds. As a halogenated compound, it can participate in nucleophilic substitution reactions, making it valuable in organic synthesis and medicinal chemistry. However, it should be handled with care due to its potential toxicity and irritant properties. Proper safety measures, including the use of personal protective equipment, are recommended when working with this substance in a laboratory setting.
Formula:C8H9ClS
InChI:InChI=1S/C8H9ClS/c1-10-8-4-2-7(6-9)3-5-8/h2-5H,6H2,1H3
InChI key:InChIKey=VWVZFHRDLPHBEG-UHFFFAOYSA-N
SMILES:C(Cl)C1=CC=C(SC)C=C1
Synonyms:- 1-(Chloromethyl)-4-(Methylsulfanyl)Benzene
- 1-(Chloromethyl)-4-(methylthio)benzene
- 1-Chloromethyl-4-methylsulfanylbenzene
- 1-Chloromethyl-4-methylthiobenzene
- 4-(Chloromethyl)thioanisole
- 4-(Methylsulfanyl)benzyl chloride
- 4-(Methylthio)benzyl chloride
- Benzene, 1-(chloromethyl)-4-(methylthio)-
- Sulfide, α-chloro-p-tolyl methyl
- p-(Methylthio)benzyl chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-(Methylthio)benzyl chloride
CAS:Formula:C8H9ClSPurity:98%Color and Shape:LiquidMolecular weight:172.67514-(Methylthio)benzyl chloride
CAS:Formula:C8H9ClSPurity:98%Color and Shape:LiquidMolecular weight:172.674-(Methylthio)benzylchloride
CAS:4-(Methylthio)benzylchloride is a molecule that belongs to the group of dendrons. It is a synthetic molecule with an acid chloride functional group. This compound has been synthesized by decarboxylation of 4-methylthiobenzaldehyde and then chlorination of the resulting alcohol. The microextraction technique was used to extract 4-(methylthio)benzylchloride from acidic solutions. In this technique, a small amount of solvent is absorbed on a solid phase and then eluted into another solvent in a laboratory instrument called the headspace. The headspace technique is used to extract 4-(methylthio)benzylchloride from acidic solutions because it has better sensitivity and selectivity than liquid-liquid extraction. The fluorescence properties of 4-(methylthio)benzylchloride allow it to be detected using luminescence spectroscopy at wavelengths between 400 nm and 700 nm, which makes it useful asFormula:C8H9ClSPurity:Min. 95%Molecular weight:172.68 g/mol




